123770-63-8 Usage
Description
(5-isopropylisoxazol-3-yl)methanol is a chemical compound that belongs to the isoxazole class of organic compounds. It features an isoxazole ring, which is a five-membered aromatic ring with one oxygen atom, one nitrogen atom, and three carbon atoms. The isopropyl group attached to this compound indicates a branched chain structure with the aliphatic prefix 'iso'. Additionally, it contains a methanol group, which is essentially methane with one hydrogen atom replaced by a hydroxyl group. (5-isopropylisoxazol-3-yl)methanol has a potential range of applications in the field of synthetic organic chemistry.
Uses
Used in Synthetic Organic Chemistry:
(5-isopropylisoxazol-3-yl)methanol is used as a building block for the synthesis of various organic compounds. Its unique structure, which includes an isoxazole ring and an isopropyl group, allows for the creation of a wide range of molecules with different properties and potential applications.
Used in Pharmaceutical Industry:
(5-isopropylisoxazol-3-yl)methanol is used as a starting material or intermediate in the development of new pharmaceutical compounds. Its chemical structure can be modified to create potential drug candidates with specific therapeutic properties, such as improved efficacy, selectivity, or reduced side effects.
Used in Agrochemical Industry:
(5-isopropylisoxazol-3-yl)methanol is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides. Its versatile chemical structure can be tailored to create compounds with targeted effects on specific pests or weeds, leading to more effective and environmentally friendly products.
Used in Material Science:
(5-isopropylisoxazol-3-yl)methanol is used as a component in the development of new materials with unique properties, such as improved strength, flexibility, or thermal stability. Its incorporation into polymers or other materials can lead to the creation of advanced materials for various applications, including electronics, automotive, and aerospace industries.
Check Digit Verification of cas no
The CAS Registry Mumber 123770-63-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,7,7 and 0 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 123770-63:
(8*1)+(7*2)+(6*3)+(5*7)+(4*7)+(3*0)+(2*6)+(1*3)=118
118 % 10 = 8
So 123770-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO2/c1-5(2)7-3-6(4-9)8-10-7/h3,5,9H,4H2,1-2H3
123770-63-8Relevant articles and documents
HYDROXYL PURINE COMPOUNDS AND USE THEREOF
-
Paragraph 0208; 0211; 0212, (2018/04/05)
Disclosed are a series of hydroxyl purine compounds and the use thereof as PDE2 or TNFα inhibitors, in particular, the compounds as shown in formula (I), or tautomers thereof or pharmaceutically acceptable salts thereof.
Regioselective syntheses of 3-aminomethyl-5-substituted isoxazoles: A facile and chemoselective reduction of azide to amino by sodium borohydride using 1,3-propanedithiol as a catalyst
Pei,Wickhan
, p. 7509 - 7512 (2007/10/02)
A series of isoxazole azides were reduced selectively to isoxazole amines in quantitative yield by sodium borohydride using 1,3-propanedithiol as a catalyst.
