154016-49-6 Usage
Uses
Used in Pharmaceutical Industry:
1-(5-isopropylisoxazol-3-yl)methanamine is used as a building block for the synthesis of pharmaceuticals due to its versatile chemical structure and potential pharmacological properties. It contributes to the development of new drugs targeting the central nervous system for the treatment of neurological disorders.
Used in Agrochemical Industry:
In the agrochemical industry, 1-(5-isopropylisoxazol-3-yl)methanamine is utilized as a building block for the synthesis of agrochemicals. Its chemical properties make it suitable for the development of new compounds with potential applications in agriculture, such as pesticides or herbicides.
Used as a Chemical Intermediate:
1-(5-isopropylisoxazol-3-yl)methanamine is used as a chemical intermediate in the production of other organic compounds. Its unique structure allows for further chemical reactions and modifications, enabling the synthesis of a wide range of organic compounds for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 154016-49-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,4,0,1 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 154016-49:
(8*1)+(7*5)+(6*4)+(5*0)+(4*1)+(3*6)+(2*4)+(1*9)=106
106 % 10 = 6
So 154016-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2O/c1-5(2)7-3-6(4-8)9-10-7/h3,5H,4,8H2,1-2H3
154016-49-6Relevant academic research and scientific papers
Pei,Wickhan
, p. 7509 - 7512 (1993)
A series of isoxazole azides were reduced selectively to isoxazole amines in quantitative yield by sodium borohydride using 1,3-propanedithiol as a catalyst.
