124069-10-9 Usage
Piperidine derivative
A derivative of piperidine This compound is based on the piperidine structure, which is a six-membered heterocyclic ring containing one nitrogen atom.
Three phenyl groups
Attached to the nitrogen atom The nitrogen atom in the piperidine ring has three phenyl groups (a benzene ring with a hydrogen atom replaced by a methyl group) attached to it.
Methyl group
At the first carbon A methyl group (a carbon atom with three hydrogen atoms) is attached to the first carbon atom in the piperidine ring.
Organic synthesis precursor
Commonly used as a precursor in organic synthesis This compound serves as a starting material or building block in the synthesis of other organic compounds.
Pharmaceutical research
Used in pharmaceutical research 1-Methyl-2,3,6-triphenyl-4-piperidinamine has potential applications in the development of new drugs.
Building block for complex organic compounds
Synthesis of other complex organic compounds This compound can be used as a building block for creating more complex organic molecules.
Health and environmental risks
Poses potential health and environmental risks Proper management and disposal of this chemical are essential to minimize risks to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 124069-10-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,0,6 and 9 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 124069-10:
(8*1)+(7*2)+(6*4)+(5*0)+(4*6)+(3*9)+(2*1)+(1*0)=99
99 % 10 = 9
So 124069-10-9 is a valid CAS Registry Number.
InChI:InChI=1/C24H25NO/c1-25-21(18-11-5-2-6-12-18)17-22(26)23(19-13-7-3-8-14-19)24(25)20-15-9-4-10-16-20/h2-16,21-24,26H,17H2,1H3