125089-02-3 Usage
General Description
4-Methyl-3-amino-2-(methoxycarbonyl)-4,5-dihydrothiophene is a chemical compound featuring a combination of various functional groups. Its molecular structure includes a thiophene ring, a type of heterocyclic compound that contains sulfur; this is bonded to a methyl group, an amino group, and a methoxycarbonyl group. Its characteristic properties, reactivity, and behavior would be determined by these groups and their interactions. Available information or specific details about this chemical, such as its physical properties (melting point, boiling point, solubility, etc.), its uses, production methods, toxicity or potential health effects, are not widely documented in scientific literature, pointing to its niche nature within the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 125089-02-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,0,8 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 125089-02:
(8*1)+(7*2)+(6*5)+(5*0)+(4*8)+(3*9)+(2*0)+(1*2)=113
113 % 10 = 3
So 125089-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO2S/c1-4-3-11-6(5(4)8)7(9)10-2/h4H,3,8H2,1-2H3
