125089-02-3 Usage
Uses
Due to the limited information available, the specific applications of 4-Methyl-3-amino-2-(methoxycarbonyl)-4,5-dihydrothiophene are not well-defined. However, based on the functional groups present in its structure, it can be inferred that 4-METHYL-3-AMINO-2-(METHOXYCARBONYL)-4,5-DIHYDROTHIOPHENE may have potential uses in various industries, such as:
Used in Pharmaceutical Industry:
4-Methyl-3-amino-2-(methoxycarbonyl)-4,5-dihydrothiophene could be used as an intermediate or building block in the synthesis of pharmaceutical compounds. The presence of the thiophene ring, amino, and methoxycarbonyl groups may allow for the development of new drugs with unique properties and therapeutic effects.
Used in Chemical Synthesis:
In the field of organic chemistry, 4-Methyl-3-amino-2-(methoxycarbonyl)-4,5-dihydrothiophene may serve as a starting material or intermediate in the synthesis of more complex molecules. Its functional groups could be utilized in various chemical reactions, leading to the formation of new compounds with potential applications in different industries.
Used in Material Science:
4-METHYL-3-AMINO-2-(METHOXYCARBONYL)-4,5-DIHYDROTHIOPHENE's structure may also lend itself to applications in material science, where it could be used as a component in the development of new materials with specific properties. The thiophene ring, in particular, is known to be a key structural element in many conductive polymers and organic semiconductors, suggesting potential uses in electronic devices or sensors.
Check Digit Verification of cas no
The CAS Registry Mumber 125089-02-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,0,8 and 9 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 125089-02:
(8*1)+(7*2)+(6*5)+(5*0)+(4*8)+(3*9)+(2*0)+(1*2)=113
113 % 10 = 3
So 125089-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO2S/c1-4-3-11-6(5(4)8)7(9)10-2/h4H,3,8H2,1-2H3
