1255-02-3 Usage
Uses
1. Used in Pharmaceutical Industry:
CARAPANAUBINE is used as a pharmaceutical compound for its potential therapeutic applications. Its unique chemical structure and properties make it a promising candidate for the development of new drugs and therapies.
2. Used in Research and Development:
CARAPANAUBINE serves as a valuable research tool in the field of natural product chemistry and pharmacology. Its study can lead to a better understanding of the biological activities and mechanisms of action of similar alkaloids, potentially leading to the discovery of new therapeutic agents.
3. Used in Drug Discovery:
Due to its unique chemical properties and potential biological activities, CARAPANAUBINE can be used as a starting point for the synthesis of new compounds with improved pharmacological profiles. This can be particularly useful in the development of novel drugs targeting various diseases and conditions.
4. Used in Traditional Medicine:
As an alkaloid from Rauwolfia vomitora, CARAPANAUBINE may also have applications in traditional medicine practices, where the plant has been used for centuries for its various therapeutic properties. Further research and validation are needed to explore these potential uses.
References
Pousset., Trav. Lab. Matiere Med. Pharm. Galenique Fac. Pharm., 52, II, 13
(1967)
Pousset et al., Bull. Soc. Chim. Fr., 2766 (1967)
Check Digit Verification of cas no
The CAS Registry Mumber 1255-02-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,5 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1255-02:
(6*1)+(5*2)+(4*5)+(3*5)+(2*0)+(1*2)=53
53 % 10 = 3
So 1255-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C23H28N2O6/c1-12-14-10-25-6-5-23(20(25)7-13(14)15(11-31-12)21(26)30-4)16-8-18(28-2)19(29-3)9-17(16)24-22(23)27/h8-9,11-14,20H,5-7,10H2,1-4H3,(H,24,27)/t12-,13-,14-,20-,23+/m0/s1