1256254-36-0 Usage
General Description
3-bromo-4,6-dichloro-2,5-dimethylpyridine is a chemical compound with the molecular formula C7H6BrCl2N. It is a derivative of pyridine, and it contains three different halogen atoms. 3-bromo-4,6-dichloro-2,5-dimethylpyridine is used in the field of organic chemistry as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its specific chemical structure and properties make it useful for introducing specific functional groups into complex molecules. Additionally, it can also be used as a reagent in the development of new synthetic methodologies. Overall, 3-bromo-4,6-dichloro-2,5-dimethylpyridine plays a significant role in the synthesis of various organic compounds and is a valuable tool for chemists in their research and development efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 1256254-36-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,5,6,2,5 and 4 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1256254-36:
(9*1)+(8*2)+(7*5)+(6*6)+(5*2)+(4*5)+(3*4)+(2*3)+(1*6)=150
150 % 10 = 0
So 1256254-36-0 is a valid CAS Registry Number.
InChI:InChI=1S/C7H6BrCl2N/c1-3-6(9)5(8)4(2)11-7(3)10/h1-2H3