1256254-36-0 Usage
Uses
Used in Organic Chemistry:
3-bromo-4,6-dichloro-2,5-dimethylpyridine is used as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its specific chemical structure and properties allow for the introduction of specific functional groups into complex molecules, making it a valuable component in the development of new compounds with potential therapeutic or agricultural applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-bromo-4,6-dichloro-2,5-dimethylpyridine is used as a key intermediate in the synthesis of drugs. Its unique structure contributes to the creation of novel molecules with specific therapeutic effects, enhancing the range of treatments available for various medical conditions.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, 3-bromo-4,6-dichloro-2,5-dimethylpyridine is utilized as a precursor in the development of new pesticides and other agricultural chemicals. Its incorporation into these products can lead to more effective and targeted pest control solutions.
Used in Research and Development:
3-bromo-4,6-dichloro-2,5-dimethylpyridine also serves as a reagent in the development of new synthetic methodologies. Its unique properties make it a valuable tool for chemists in their research and development efforts, contributing to the advancement of chemical synthesis techniques and the discovery of new chemical entities.
Overall, 3-bromo-4,6-dichloro-2,5-dimethylpyridine plays a significant role in the synthesis of various organic compounds and is a valuable asset in the fields of pharmaceuticals, agrochemicals, and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 1256254-36-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,5,6,2,5 and 4 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1256254-36:
(9*1)+(8*2)+(7*5)+(6*6)+(5*2)+(4*5)+(3*4)+(2*3)+(1*6)=150
150 % 10 = 0
So 1256254-36-0 is a valid CAS Registry Number.
InChI:InChI=1S/C7H6BrCl2N/c1-3-6(9)5(8)4(2)11-7(3)10/h1-2H3
