126318-27-2 Usage
Uses
Used in Pharmaceutical Research:
3-Nitrobenzo[b]furan-5-ol is used as a chemical intermediate in the synthesis of various pharmaceutical compounds. Its unique structure, including the nitro and hydroxyl functional groups, allows for further chemical modifications and the development of new drug candidates with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 3-nitrobenzo[b]furan-5-ol serves as a valuable compound for studying the properties and reactivity of benzo-furan derivatives. Its presence in various chemical reactions can provide insights into the behavior of similar compounds and contribute to the understanding of organic chemistry principles.
Used in Material Science:
3-Nitrobenzo[b]furan-5-ol may also find applications in material science, particularly in the development of new materials with specific properties. Its aromatic and heterocycle structure can be exploited to create novel polymers, coatings, or other materials with unique characteristics for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 126318-27-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,3,1 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 126318-27:
(8*1)+(7*2)+(6*6)+(5*3)+(4*1)+(3*8)+(2*2)+(1*7)=112
112 % 10 = 2
So 126318-27-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H5NO4/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-4,10H
126318-27-2Relevant articles and documents
LACTAM AND ACID AMIDE ACETALS. 58. NEW SYNTHESIS OF 3-NITRO-5-HYDROXYBENZOFURANS
Lyubchanskaya, V. M.,Granik, V. G.
, p. 503 - 506 (2007/10/02)
Previously unknown 3-nitro-5-hydroxybenzofuran derivatives were obtained by condensation of p-benzoquinones with nitro enamines.
