126403-67-6 Usage
Uses
Used in Pharmaceutical Industry:
2-METHYLPROPYLZINC BROMIDE is used as a reagent in the palladium-catalyzed Negishi cross-coupling reaction for constructing carbon-carbon bonds. This reaction is crucial in the synthesis of complex organic molecules, including pharmaceutical compounds, due to its ability to form stable and diverse molecular structures.
Used in Chemical Synthesis:
2-METHYLPROPYLZINC BROMIDE is used as a reagent for preparing regioselective unsaturated ketones. This is achieved by reacting with tert-butyl isocyanide through an allylic carbonylative coupling reaction in the presence of a nickel catalyst. This process is valuable in the synthesis of specific organic compounds with desired properties and applications in various industries.
Used in Research and Development:
2-METHYLPROPYLZINC BROMIDE is utilized as a research reagent to explore new synthetic pathways and develop innovative chemical processes. Its unique reactivity and compatibility with various catalysts make it a valuable tool for advancing scientific knowledge and creating new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 126403-67-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,4,0 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 126403-67:
(8*1)+(7*2)+(6*6)+(5*4)+(4*0)+(3*3)+(2*6)+(1*7)=106
106 % 10 = 6
So 126403-67-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H9.BrH.Zn/c1-4(2)3;;/h4H,1H2,2-3H3;1H;/q;;+1/p-1/rC4H9BrZn/c1-4(2)3-6-5/h4H,3H2,1-2H3
