12712-75-3 Usage
Purine derivative
The compound contains a purine derivative, which is a derivative of the naturally occurring substance xanthine.
Ester group
The compound contains an ester group, which is a 4-(diethylamino)-4-oxobutyrate moiety.
Biological activity
The purine group in the compound may have various effects on the central nervous system and other physiological processes, giving the compound potential biological activity.
Lipophilicity
The ester group in the compound may contribute to its ability to penetrate cell membranes, making it more lipophilic.
Unique structure
The compound has a unique structure that suggests it may have interesting and potentially valuable biological properties.
Further research needed
While the compound's properties and potential uses are not yet fully understood, further research is needed to fully explore its potential.
Check Digit Verification of cas no
The CAS Registry Mumber 12712-75-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,7,1 and 2 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 12712-75:
(7*1)+(6*2)+(5*7)+(4*1)+(3*2)+(2*7)+(1*5)=83
83 % 10 = 3
So 12712-75-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H25N5O5/c1-5-21(6-2)12(23)7-8-13(24)27-10-9-22-11-18-15-14(22)16(25)20(4)17(26)19(15)3/h11H,5-10H2,1-4H3