127827-50-3 Usage
Uses
Used in Organic Synthesis:
6,7-Difluoroquinoline is used as a key intermediate in the synthesis of other organic compounds. Its unique structure and reactivity make it a valuable building block for creating a variety of complex molecules, which can be utilized in different chemical and pharmaceutical applications.
Used in Pharmaceutical Industry:
6,7-Difluoroquinoline is used as a starting material for the development of new pharmaceutical compounds. Its chemical properties, such as stability and solubility, are crucial for the design and synthesis of potential drug candidates. The ongoing research into its properties and potential uses indicates that it may play a significant role in the discovery of novel therapeutic agents.
Used in Research and Development:
6,7-Difluoroquinoline is used as a research compound in academic and industrial laboratories. Its unique properties and potential applications make it an interesting subject for studies aimed at understanding its reactivity, stability, and interactions with other molecules. This research can lead to the discovery of new applications and uses for 6,7-DIFLUOROQUINOLINE in various fields, including materials science and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 127827-50-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,8,2 and 7 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 127827-50:
(8*1)+(7*2)+(6*7)+(5*8)+(4*2)+(3*7)+(2*5)+(1*0)=143
143 % 10 = 3
So 127827-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H5F2N/c10-7-4-6-2-1-3-12-9(6)5-8(7)11/h1-5H
