128276-50-6 Usage
Uses
Used in Biochemical Research:
4,6-Dimethoxypyrimidine-2-Carboxylic Acid is used as a research compound for studying the structure and properties of pyrimidine derivatives. Its unique chemical characteristics make it a valuable tool in understanding the behavior of similar compounds and their potential applications in various fields.
Used in Pharmaceutical Industries:
4,6-Dimethoxypyrimidine-2-Carboxylic Acid is used as an intermediate or building block in the synthesis of various pharmaceutical compounds. Its reactivity and polarity allow for the creation of new drug molecules with potential therapeutic applications, making it an important component in the development of novel medications.
Used in Drug Synthesis:
4,6-Dimethoxypyrimidine-2-Carboxylic Acid is used as a key component in the synthesis of certain drugs, particularly those targeting specific biological pathways or receptors. Its presence in the molecular structure can influence the drug's efficacy, stability, and pharmacokinetic properties, making it a crucial element in the design and development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 128276-50-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,2,7 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 128276-50:
(8*1)+(7*2)+(6*8)+(5*2)+(4*7)+(3*6)+(2*5)+(1*0)=136
136 % 10 = 6
So 128276-50-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O4/c1-12-4-3-5(13-2)9-6(8-4)7(10)11/h3H,1-2H3,(H,10,11)
128276-50-6Relevant academic research and scientific papers
Heterocyclic N-acylsulfonamides, and their use as herbicides or growth regulators
-
, (2008/06/13)
Compounds of the formula I or salts thereof STR1 where R1 is H or an aliphatic radical; R2 and R3 are H, alkyl or phenyl; W is O, S, NR4 or NOR4 ; X is CHR2, O or NR4 ; L is a (s