128924-91-4 Usage
Explanation
Different sources of media describe the Explanation of 128924-91-4 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of the compound.
2. This is the full name of the compound, which describes its structure and composition.
3. Chelating agent
3. A chelating agent is a molecule that can form multiple bonds with a single metal ion, effectively trapping it.
4. The compound is capable of forming stable complexes with these specific metal ions, which is useful in various applications.
5. Complex structure and functional groups
5. The compound's structure and functional groups, such as the 4-nitrobenzyl group and the tetraacetic acid groups, contribute to its ability to effectively trap metal ions.
6. Due to its ability to bind metal ions, the compound can be used in these fields to improve imaging techniques, deliver drugs more effectively, and detect metal ions in various samples.
7. 4-nitrobenzyl group
7. This functional group is attached to the tetraazacyclotridecane core, providing increased stability and selectivity towards certain metal ions.
8. Versatile tool in biological and chemical research
8. The compound's ability to bind various metal ions and its stability make it a valuable tool for researchers in both biology and chemistry.
Chemical compound
12-(4-nitrobenzyl)-1,4,7,10-tetraazacyclotridecane-1,4,7,10-tetraacetic acid
Binds to metal ions
Calcium, copper, and zinc
Applications
Medical imaging, drug delivery, and metal ion detection
Check Digit Verification of cas no
The CAS Registry Mumber 128924-91-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,9,2 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 128924-91:
(8*1)+(7*2)+(6*8)+(5*9)+(4*2)+(3*4)+(2*9)+(1*1)=154
154 % 10 = 4
So 128924-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H35N5O10/c30-21(31)14-25-5-6-26(15-22(32)33)8-10-28(17-24(36)37)13-19(12-27(9-7-25)16-23(34)35)11-18-1-3-20(4-2-18)29(38)39/h1-4,19H,5-17H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37)
128924-91-4Relevant articles and documents
Accelerating water exchange for GDIII chelates by steric compression around the water binding site
Ruloff, Robert,Toth, Eva,Scopelliti, Rosario,Tripier, Raphael,Handel, Henri,Merbach, Andre E.
, p. 2630 - 2631 (2007/10/03)
The water exchange process was accelerated for nine-coordinate, monohydrated macrocyclic GdIII complexes by inducing steric compression around the water binding site; the increased steric crowding was achieved by replacing an ethylene bridge of