128924-91-4 Usage
General Description
12-(4-nitrobenzyl)-1,4,7,10-tetraazacyclotridecane-1,4,7,10-tetraacetic acid is a chemical compound with the molecular formula C26H38N6O8. It is a chelating agent commonly used in the field of chemistry and biochemistry to bind to metal ions, such as calcium, copper, and zinc. The compound's complex structure and functional groups allow it to effectively trap metal ions, making it useful in various applications such as medical imaging, drug delivery, and metal ion detection. The 4-nitrobenzyl group attached to the tetraazacyclotridecane core provides the compound with increased stability and selectivity towards certain metal ions, making it a versatile tool in biological and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 128924-91-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,9,2 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 128924-91:
(8*1)+(7*2)+(6*8)+(5*9)+(4*2)+(3*4)+(2*9)+(1*1)=154
154 % 10 = 4
So 128924-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H35N5O10/c30-21(31)14-25-5-6-26(15-22(32)33)8-10-28(17-24(36)37)13-19(12-27(9-7-25)16-23(34)35)11-18-1-3-20(4-2-18)29(38)39/h1-4,19H,5-17H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37)
128924-91-4Relevant articles and documents
Accelerating water exchange for GDIII chelates by steric compression around the water binding site
Ruloff, Robert,Toth, Eva,Scopelliti, Rosario,Tripier, Raphael,Handel, Henri,Merbach, Andre E.
, p. 2630 - 2631 (2007/10/03)
The water exchange process was accelerated for nine-coordinate, monohydrated macrocyclic GdIII complexes by inducing steric compression around the water binding site; the increased steric crowding was achieved by replacing an ethylene bridge of