129101-37-7 Usage
Description
(R)-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid is an organic compound that serves as a valuable reagent in the field of organic synthesis. It is characterized by its unique chemical structure, which includes a fluorine atom at the 6-position and a carboxylic acid group at the 2-position of the benzopyran ring system. This structure endows the compound with specific reactivity and properties that make it useful in various chemical reactions and applications.
Uses
Used in Pharmaceutical Industry:
(R)-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, particularly in the treatment of various diseases and conditions.
Used in Chemical Research:
In the field of chemical research, (R)-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid serves as a key building block for the synthesis of complex organic molecules. Its reactivity and structural features make it an attractive candidate for the development of novel chemical entities with potential applications in various industries, including materials science, agrochemistry, and environmental science.
Used in Organic Synthesis:
(R)-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid is used as a versatile reagent in organic synthesis, enabling the preparation of a wide range of chemical products. Its unique structure allows for various functional group transformations and reactions, making it a valuable tool for the synthesis of complex organic molecules with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 129101-37-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,1,0 and 1 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 129101-37:
(8*1)+(7*2)+(6*9)+(5*1)+(4*0)+(3*1)+(2*3)+(1*7)=97
97 % 10 = 7
So 129101-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H9FO3/c11-7-2-4-8-6(5-7)1-3-9(14-8)10(12)13/h2,4-5,9H,1,3H2,(H,12,13)/t9-/m1/s1
129101-37-7Relevant articles and documents
Preparation method of chromanone 2-carboxylic acid or chroman 2-carboxylic acid derivatives
-
, (2017/05/16)
The present invention relates to a chromanone-2-carboxylic acid derivative and a chroman-2-carboxylic acid derivative which can be used as an intermediate for effective medicinal components currently available in the market, and to preparation methods the
PROCESS FOR THE PREPARATION OF NEBIVOLOL
-
Page/Page column 16-18, (2012/07/28)
The present invention relates to a novel process for the synthesis of the Nebivolol product depicted in Scheme 1, comprised of a reduced number of high-yield steps, and characterized by the enzymatic resolution of the chroman ester precursor.