129601-50-9 Usage
Structure
Mimics netropsin
Designed to have a similar structure and function as the natural antibiotic netropsin.
DNA binding
Inhibits DNA replication
Known for its ability to bind to DNA and inhibit its replication, which can be useful in stopping viral and cancer cell growth.
Antiviral potential
Interferes with viral DNA-binding proteins
Effectively interferes with the DNA-binding proteins of viruses, making it a potential antiviral agent.
Anticancer potential
Targets cancer cell DNA
Can disrupt the function of DNA in cancer cells, making it a potential anticancer agent.
Target specificity
Unique chemical structure
The unique chemical structure of 1-methylimidazole-2-carboxamide netropsin allows it to target specific sequences of DNA.
Therapeutic applications
Targeted therapeutics
Due to its target specificity, it is a promising candidate for the development of targeted therapeutics for various diseases and conditions.
Ongoing research
Exploring potential applications
Current research is focused on investigating the potential applications of 1-methylimidazole-2-carboxamide netropsin in treating a range of diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 129601-50-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,6,0 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 129601-50:
(8*1)+(7*2)+(6*9)+(5*6)+(4*0)+(3*1)+(2*5)+(1*0)=119
119 % 10 = 9
So 129601-50-9 is a valid CAS Registry Number.
InChI:InChI=1/C22H30N8O3/c1-27(2)9-6-7-24-20(31)17-11-15(13-29(17)4)25-21(32)18-12-16(14-30(18)5)26-22(33)19-23-8-10-28(19)3/h8,10-14H,6-7,9H2,1-5H3,(H,24,31)(H,25,32)(H,26,33)
129601-50-9Relevant articles and documents
Design of peptides that bind in the minor groove of DNA at 5′-(A,T)G(A,T)C(A,T)-3′ sequences by a dimeric side-by-side motif
Wade, Warren S.,Mrksich, Milan,Dervan, Peter B.
, p. 8783 - 8794 (1992)
The designed peptides pyridine-2-carboxamide-netropsin (2-PyN) and 1-methylimidazole-2-carboxamide-netropsin (2-ImN) are crescent-shaped synthetic analogs of the natural products netropsin (N) and distamycin A (D). Footprinting experiments indicate that the peptides 2-PyN and 2-ImN bind specifically the 5 base pair sequence 5′-TGTCA-3′. Affinity cleaving data suggest that the complexes, 2-ImN·5′-TGTCA-3′ and 2-PyN·5′-TGTCA-3′, are composed of two equivalent orientations which disfavor a 1:1 model. The footprinting and affinity cleaving data are in accord with a 2:1 complex where a novel side-by-side antiparallel dimer binds in the minor groove of double-helical DNA.