129752-86-9 Usage
Uses
Used in Organic Synthesis:
2,4-Dichlorobenzylmagnesium chloride is used as a reagent for the formation of carbon-carbon bonds through Grignard reactions. Its strong nucleophilic nature allows it to react with various electrophiles, leading to the formation of a wide range of organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,4-dichlorobenzyl magnesium chloride is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its ability to form carbon-carbon bonds makes it a valuable tool in the development of new drugs and medicinal agents.
Used in Chemical Research:
2,4-Dichlorobenzylmagnesium chloride is also utilized in chemical research as a source of the 2,4-dichlorobenzyl anion for various organic transformations. Its unique properties make it a valuable asset in the exploration of new chemical reactions and the synthesis of novel compounds.
Overall, 2,4-dichlorobenzylmagnesium chloride plays a crucial role in the field of organic chemistry, serving as a versatile and powerful reagent for the synthesis of complex organic molecules across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 129752-86-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,7,5 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 129752-86:
(8*1)+(7*2)+(6*9)+(5*7)+(4*5)+(3*2)+(2*8)+(1*6)=159
159 % 10 = 9
So 129752-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Cl2.ClH.Mg/c1-5-2-3-6(8)4-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5Cl3Mg/c8-6-2-1-5(4-11-10)7(9)3-6/h1-3H,4H2
129752-86-9Relevant academic research and scientific papers
CHEMICAL COMPOUNDS
-
Page 85, (2010/02/06)
Compounds of formula (I):wherein variable groups are as defined within; for use in the inhibition of 11betaHSD1 are described
