130284-56-9 Usage
General Description
2-Bromo-3-chloro-5-hydroxypyridine is a chemical compound with the molecular formula C5H3BrClNO that contains a pyridine ring substituted with bromine, chlorine, and a hydroxy group. It is often used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and organic compounds. This chemical is known for its ability to undergo various reactions, including nucleophilic substitution and oxidative transformations, making it a valuable building block in organic synthesis. Additionally, 2-Bromo-3-chloro-5-hydroxypyridine is known for its potential as a reactive and versatile reagent in the field of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 130284-56-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,2,8 and 4 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 130284-56:
(8*1)+(7*3)+(6*0)+(5*2)+(4*8)+(3*4)+(2*5)+(1*6)=99
99 % 10 = 9
So 130284-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrClNO/c6-5-4(7)1-3(9)2-8-5/h1-2,9H