130964-01-1 Usage
Uses
Used in Polymer and Resin Synthesis:
N-(3-phenylprop-2-enyl)benzene-1,2-diamine is utilized as a monomer for the production of various polymers and resins. Its unique structure allows for the creation of materials with tailored properties, such as enhanced stability, reactivity, or specific binding capabilities.
Used in Coordination Chemistry:
In coordination chemistry, N-(3-phenylprop-2-enyl)benzene-1,2-diamine acts as a ligand, enabling the formation of metal complexes with diverse applications. Its presence can influence the electronic, geometric, and magnetic properties of the resulting complexes, making it a valuable component in the design of new coordination compounds.
Used in Catalysis:
As a ligand in catalytic systems, N-(3-phenylprop-2-enyl)benzene-1,2-diamine contributes to the enhancement of catalytic activity and selectivity. Its ability to form stable complexes with metal centers can improve the efficiency of catalytic processes in various chemical reactions.
Used in Pharmaceutical Industry:
N-(3-phenylprop-2-enyl)benzene-1,2-diamine holds potential in the pharmaceutical industry due to its unique structural and functional properties. It may be employed in the development of new drugs, particularly in the areas of medicinal chemistry and drug design, where its versatility can be leveraged to create novel therapeutic agents.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, N-(3-PHENYLPROP-2-ENYL)BENZENE-1,2-DIAMINE may find applications in the development of new pesticides, herbicides, or other agrochemicals. Its structural features can be exploited to design molecules with specific target interactions, potentially leading to more effective and environmentally friendly products.
Check Digit Verification of cas no
The CAS Registry Mumber 130964-01-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,9,6 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 130964-01:
(8*1)+(7*3)+(6*0)+(5*9)+(4*6)+(3*4)+(2*0)+(1*1)=111
111 % 10 = 1
So 130964-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2/c16-14-10-4-5-11-15(14)17-12-6-9-13-7-2-1-3-8-13/h1-11,17H,12,16H2/b9-6+
130964-01-1Relevant academic research and scientific papers
Metal-free TEMPO-promoted C(sp3)-H amination to afford multisubstituted benzimidazoles
Xue, Ding,Long, Ya-Qiu
, p. 4727 - 4734 (2014/06/09)
An efficient TEMPO-air/cat. TEMPO-O2 oxidative protocol was developed to synthesize multisubstituted or fused tetracyclic benzimidazoles via a metal-free oxidative C-N coupling between the sp3 C-H and free N-H of readily available N1-benzyl/alkyl-1,2-phenylenediamines.
