131337-81-0 Usage
Uses
Used in Pharmaceutical Industry:
THIENO[2,3-B]PYRIDIN-2-YLMETHANOL is used as a key intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new molecules with significant biological activity. Its unique structure allows for the creation of compounds that can target specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical sector, THIENO[2,3-B]PYRIDIN-2-YLMETHANOL is utilized as an intermediate in the production of agrochemicals, potentially leading to the development of new pesticides or herbicides with improved efficacy and selectivity.
Used in Material Science:
THIENO[2,3-B]PYRIDIN-2-YLMETHANOL may also have potential uses in the development of new materials, given its unique structural properties that could be leveraged in the design of advanced materials with specific characteristics.
Used in Academic Research:
THIENO[2,3-B]PYRIDIN-2-YLMETHANOL is employed in academic research, particularly in the field of organic chemistry, where it can be used to explore novel synthetic pathways, investigate its reactivity, and study its properties to further understand its potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 131337-81-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,3,3 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 131337-81:
(8*1)+(7*3)+(6*1)+(5*3)+(4*3)+(3*7)+(2*8)+(1*1)=100
100 % 10 = 0
So 131337-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NOS/c10-5-7-4-6-2-1-3-9-8(6)11-7/h1-4,10H,5H2
