132992-28-0 Usage
Uses
Used in Pharmaceutical Industry:
2,3,5-Trifluorophenylacetic acid is used as a building block for the synthesis of various pharmaceuticals. Its strong electron-withdrawing properties and versatile reactivity make it an essential component in the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 2,3,5-Trifluorophenylacetic acid is utilized as a precursor for the synthesis of agrochemicals, such as pesticides and herbicides. Its unique chemical properties contribute to the creation of more effective and targeted agrochemicals for agricultural applications.
Used in Organic Synthesis:
2,3,5-Trifluorophenylacetic acid is employed as a reagent in organic synthesis, facilitating the formation of various complex chemical compounds. Its electron-withdrawing effects and reactivity with other molecules make it a valuable tool in the synthesis of a wide range of organic compounds for various applications.
Used in Research and Development:
As a versatile intermediate in organic chemistry, 2,3,5-Trifluorophenylacetic acid is used in research and development for the exploration of new chemical reactions and the synthesis of novel compounds. Its unique properties and reactivity provide opportunities for scientists to discover new applications and advancements in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 132992-28-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,9,9 and 2 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 132992-28:
(8*1)+(7*3)+(6*2)+(5*9)+(4*9)+(3*2)+(2*2)+(1*8)=140
140 % 10 = 0
So 132992-28-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F3O2/c9-5-1-4(2-7(12)13)8(11)6(10)3-5/h1,3H,2H2,(H,12,13)
