133081-24-0 Usage
Description
6-Hydrazinonicotinic acid, with the molecular formula C6H8N4O2, is a significant chemical compound that serves as a crucial intermediate in the synthesis of pharmaceuticals and agrochemicals. Its versatile applications and role as a precursor in the synthesis of biologically active molecules make it a valuable and indispensable chemical in both the pharmaceutical and agrochemical industries.
Uses
Used in Pharmaceutical Industry:
6-Hydrazinonicotinic acid is used as an intermediate in the synthesis of drugs such as isoniazid, an effective treatment for tuberculosis. It plays a critical role in the development of new pharmaceuticals by providing a foundation for the creation of various biologically active molecules.
Used in Agrochemical Industry:
6-Hydrazinonicotinic acid is used as a key building block in the production of various types of pesticides, herbicides, and fungicides. Its presence in these products helps to control and manage pests, weeds, and diseases in agricultural settings, contributing to increased crop yields and food security.
Used in Organic Compound Synthesis:
6-Hydrazinonicotinic acid is used as a precursor in the preparation of several other organic compounds. Its unique chemical structure allows for the development of a wide range of organic molecules with diverse applications in various industries, including chemical manufacturing, materials science, and research.
Check Digit Verification of cas no
The CAS Registry Mumber 133081-24-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,3,0,8 and 1 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 133081-24:
(8*1)+(7*3)+(6*3)+(5*0)+(4*8)+(3*1)+(2*2)+(1*4)=90
90 % 10 = 0
So 133081-24-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3O2/c7-9-5-2-1-4(3-8-5)6(10)11/h1-3H,7H2,(H,8,9)(H,10,11)
