13324-13-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Methoxy-2-nitrobenzoic acid ethyl ester is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its versatile reactivity allows for the production of a wide range of drug compounds, contributing to the development of new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Methoxy-2-nitrobenzoic acid ethyl ester is utilized as an intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its chemical properties enable the creation of effective compounds for agricultural applications.
Used in Organic Chemistry Research:
4-Methoxy-2-nitrobenzoic acid ethyl ester is used as a research compound in organic chemistry due to its ability to undergo various chemical reactions, including esterification and nitration. This makes it a valuable tool for studying reaction mechanisms and developing new synthetic methods.
Used in Antioxidant and Anti-Inflammatory Drug Development:
4-Methoxy-2-nitrobenzoic acid ethyl ester is used as a potential candidate for the development of new drug therapies, owing to its antioxidant and anti-inflammatory properties. Its unique chemical structure allows for the exploration of its potential in treating various diseases and conditions related to oxidative stress and inflammation.
Check Digit Verification of cas no
The CAS Registry Mumber 13324-13-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,2 and 4 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13324-13:
(7*1)+(6*3)+(5*3)+(4*2)+(3*4)+(2*1)+(1*3)=65
65 % 10 = 5
So 13324-13-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO5/c1-3-16-10(12)8-5-4-7(15-2)6-9(8)11(13)14/h4-6H,3H2,1-2H3
