13338-82-4 Usage
Uses
Used in Epoxy Resin Industry:
4-(Aminomethyl)cyclohexylamine is used as a curing agent for epoxy resins, where it functions as a hardener. This application is crucial for creating strong and durable polymer materials that are essential in various industrial and manufacturing processes.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 4-(Aminomethyl)cyclohexylamine serves as a building block for the synthesis of various drug molecules. Its chemical properties make it a valuable component in the development of new medications, contributing to advancements in healthcare and medicine.
Given the high reactivity of 4-AMCHA, it is imperative that safety measures are taken during its handling and use to mitigate the risk of irritation and toxic effects. This underscores the importance of proper training and adherence to safety protocols in industries where 4-(Aminomethyl)cyclohexylamine is employed.
Check Digit Verification of cas no
The CAS Registry Mumber 13338-82-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,3 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 13338-82:
(7*1)+(6*3)+(5*3)+(4*3)+(3*8)+(2*8)+(1*2)=94
94 % 10 = 4
So 13338-82-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N2/c8-5-6-1-3-7(9)4-2-6/h6-7H,1-5,8-9H2
13338-82-4Relevant academic research and scientific papers
PROCESS FOR PREPARING CYCLIC DIAMINES
-
Page/Page column 27-29, (2010/06/15)
The present invention relates to a process for preparing a cyclic diamine, comprising the reaction of at least one cyclic alkene with a gas mixture (G) comprising dinitrogen monoxide to give at least one cyclic ketone and the subsequent conversion of the
