134068-43-2 Usage
Description
[5-(2-CHLORO-ACETYL)-10,11-DIHYDRO-5 H-DIBENZO[ B , F ]AZEPIN-3-YL]-CARBAMIC ACID METHYL ESTER is a complex chemical compound that belongs to the class of carbamic acid methyl esters. It features a chloroacetyl group and a dibenzoazepin ring, which may contribute to its potential pharmaceutical applications. Due to its unique structure and properties, it requires careful handling to mitigate risks to human health and the environment. Further research and testing are essential to explore its characteristics and possible uses.
Uses
[5-(2-CHLORO-ACETYL)-10,11-DIHYDRO-5 H-DIBENZO[ B , F ]AZEPIN-3-YL]-CARBAMIC ACID METHYL ESTER is used as a potential pharmaceutical agent for its unique structure and properties that may offer therapeutic benefits.
Used in Pharmaceutical Industry:
[5-(2-CHLORO-ACETYL)-10,11-DIHYDRO-5 H-DIBENZO[ B , F ]AZEPIN-3-YL]-CARBAMIC ACID METHYL ESTER is used as a candidate for drug development for its potential to contribute to the treatment of various medical conditions, given its distinctive molecular composition. The specific application reasons and therapeutic areas would depend on the outcomes of ongoing research and testing, which are necessary to determine its safety, efficacy, and appropriate uses.
Check Digit Verification of cas no
The CAS Registry Mumber 134068-43-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,0,6 and 8 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 134068-43:
(8*1)+(7*3)+(6*4)+(5*0)+(4*6)+(3*8)+(2*4)+(1*3)=112
112 % 10 = 2
So 134068-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H17ClN2O3/c1-24-18(23)20-14-9-8-13-7-6-12-4-2-3-5-15(12)21(16(13)10-14)17(22)11-19/h2-5,8-10H,6-7,11H2,1H3,(H,20,23)