13468-88-7 Usage
Uses
Used in Chemical Synthesis:
4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl(6CI,7CI,8CI,9CI) is used as a key intermediate in the synthesis of other organic chemicals. Its carboxylic acid functional group allows for various chemical reactions, such as esterification, amidation, and condensation, enabling the production of a wide range of organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl(6CI,7CI,8CI,9CI) is used as a building block for the development of new drugs. Its unique chemical structure and reactivity make it a promising candidate for the synthesis of pharmaceutical compounds with potential therapeutic applications.
Used in Polymer and Material Science:
4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl(6CI,7CI,8CI,9CI) has been studied for its potential as a building block in the production of polymers and materials. Its carboxylic acid functional group can be used to form polymers with specific properties, such as biodegradability, thermal stability, and mechanical strength, making it a valuable component in the development of new materials for various applications.
Used in Research and Development:
Due to its unique chemical structure and reactivity, 4-Cyclohexene-1,2-dicarboxylic acid, 4-methyl(6CI,7CI,8CI,9CI) may have applications in various research and development processes. It can be used as a model compound to study chemical reactions, mechanisms, and properties, contributing to the advancement of scientific knowledge and the discovery of new applications.
Check Digit Verification of cas no
The CAS Registry Mumber 13468-88-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,4,6 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 13468-88:
(7*1)+(6*3)+(5*4)+(4*6)+(3*8)+(2*8)+(1*8)=117
117 % 10 = 7
So 13468-88-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2,6-7H,3-4H2,1H3,(H,10,11)(H,12,13)/t6-,7-/m0/s1
