13538-41-5 Usage
Description
Picolinamide, 6-amino(6CI,7CI,8CI), also known as 6-aminopicolinamide, is a chemical compound with the molecular formula C6H7N3O. It is a derivative of nicotinic acid and is characterized by its unique chemical structure and properties. Picolinamide, 6-amino(6CI,7CI,8CI) is primarily used in pharmaceutical and chemical research as a building block for the synthesis of various bioactive compounds and pharmaceutical drugs. Its notable anti-tuberculosis and anti-inflammatory activities make it a promising candidate for drug discovery and development. Furthermore, Picolinamide, 6-aminoalso serves as a chelating agent in metal ion coordination chemistry, contributing to its diverse applications in organic synthesis, pharmaceuticals, and materials science.
Uses
Used in Pharmaceutical Industry:
Picolinamide, 6-amino(6CI,7CI,8CI) is used as a building block for the synthesis of bioactive compounds and pharmaceutical drugs due to its unique chemical structure and properties. Its potential in drug discovery and development is attributed to its anti-tuberculosis and anti-inflammatory activities, making it a valuable component in the creation of new therapeutic agents.
Used in Chemical Research:
In the field of chemical research, Picolinamide, 6-amino(6CI,7CI,8CI) is utilized as a chelating agent in metal ion coordination chemistry. Its ability to form complexes with metal ions allows for the development of new materials and compounds with specific properties and applications.
Used in Organic Synthesis:
Picolinamide, 6-amino(6CI,7CI,8CI) is employed as a key intermediate in organic synthesis, enabling the production of a wide range of chemical compounds with diverse applications. Its unique structure and reactivity contribute to the synthesis of various organic compounds, further expanding its utility in the field of chemistry.
Used in Materials Science:
In materials science, Picolinamide, 6-amino(6CI,7CI,8CI) is utilized for the development of new materials with specific properties. Its ability to form complexes with metal ions and its involvement in the synthesis of various compounds make it a valuable component in the creation of advanced materials for different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 13538-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,5,3 and 8 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13538-41:
(7*1)+(6*3)+(5*5)+(4*3)+(3*8)+(2*4)+(1*1)=95
95 % 10 = 5
So 13538-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3O/c7-5-3-1-2-4(9-5)6(8)10/h1-3H,(H2,7,9)(H2,8,10)
13538-41-5Relevant articles and documents
Silica-sulfuric acid: Novel, simple, efficient and reusable catalyst for hydration of nitrile to amide
Chandrashekharappa, Sandeep,Venugopala, Katharigatta N.,Venugopala, Rashmi,Odhav, Bharti
, p. 2177 - 2180 (2016/07/21)
Silica-sulfuric acid efficiently catalyzes conversion of aliphatic, substituted aromatic and hetero aromatic nitriles to their corresponding amides in good to excellent yields under reflux condition. Products obtained were purified by column chromatography method and characterized by 1H NMR, 13C NMR and mass spectral analysis.
