13561-85-8 Usage
Description
(PENTAFLUOROPHENYL)ETHYLENE OXIDE is a chemical compound composed of a pentafluorophenyl group and an ethylene oxide group. It is characterized by its high reactivity and ability to undergo polymerization, making it a valuable building block in the creation of complex organic molecules. This versatile chemical plays an important role in the field of organic chemistry, particularly in the production of polymers and pharmaceuticals. However, it is crucial to handle this compound with care due to its potential hazards if not used properly.
Uses
Used in Polymer Production:
(PENTAFLUOROPHENYL)ETHYLENE OXIDE is used as a monomer in the production of polymers for various applications. Its high reactivity and ability to undergo polymerization make it a valuable building block in creating complex organic molecules with specific properties.
Used in Pharmaceutical Synthesis:
(PENTAFLUOROPHENYL)ETHYLENE OXIDE is used as an intermediate in the synthesis of pharmaceuticals. Its reactivity allows for the creation of various drug molecules with desired therapeutic properties.
Used in Chemical Reactions:
(PENTAFLUOROPHENYL)ETHYLENE OXIDE is used as a reactant in various chemical reactions, enabling the formation of new compounds with specific characteristics. Its versatility in organic chemistry makes it a valuable component in the development of novel chemical products.
Used in Research and Development:
(PENTAFLUOROPHENYL)ETHYLENE OXIDE is utilized in research and development for the exploration of new chemical reactions, synthesis processes, and the creation of innovative materials. Its unique properties and reactivity contribute to the advancement of organic chemistry and the discovery of new applications.
Check Digit Verification of cas no
The CAS Registry Mumber 13561-85-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,5,6 and 1 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13561-85:
(7*1)+(6*3)+(5*5)+(4*6)+(3*1)+(2*8)+(1*5)=98
98 % 10 = 8
So 13561-85-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H3F5O/c9-4-3(2-1-14-2)5(10)7(12)8(13)6(4)11/h2H,1H2
