13625-39-3 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
1,3,8-Triaza-spiro[4.5]decane-2,4-dione is used as a research compound in pharmaceutical research and drug development due to its potential to exhibit unique biological activities. Its specific chemical structure and properties make it a promising candidate for the development of new therapeutic agents.
Used in Chemical and Industrial Processes:
1,3,8-Triaza-spiro[4.5]decane-2,4-dione is also used in various chemical and industrial processes. Its specific chemical structure and properties allow it to be utilized in the synthesis of other compounds or as a component in the production of various materials. Its versatility and unique characteristics make it valuable in a range of applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 13625-39-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,2 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13625-39:
(7*1)+(6*3)+(5*6)+(4*2)+(3*5)+(2*3)+(1*9)=93
93 % 10 = 3
So 13625-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O2/c11-5-7(10-6(12)9-5)1-3-8-4-2-7/h8H,1-4H2,(H2,9,10,11,12)/p+1
