136326-10-8 Usage
Uses
Since the provided materials do not specify the uses of 4-Ethoxy-2-Phenyl-5-Pyrimidinecarboxylic Acid, it is not possible to list its applications based on the given information. However, given its chemical structure, it could potentially be used in various fields such as pharmaceuticals, materials science, or as an intermediate in the synthesis of other compounds. Further research and information would be required to confirm its specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 136326-10-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,3,2 and 6 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 136326-10:
(8*1)+(7*3)+(6*6)+(5*3)+(4*2)+(3*6)+(2*1)+(1*0)=108
108 % 10 = 8
So 136326-10-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2O3/c1-2-18-12-10(13(16)17)8-14-11(15-12)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,16,17)/p-1
