13691-28-6 Usage
Description
1-(4-aminophenyl)-5-methylpyrrolidin-2-one is an organic compound with the molecular formula C11H14N2O. It is a derivative of pyrrolidinone, featuring an aminophenyl group and a methyl group attached to its structure. 1-(4-aminophenyl)-5-methylpyrrolidin-2-one is known for its potential applications in various industries due to its unique chemical properties.
Uses
1. Used in Chemical Synthesis:
1-(4-aminophenyl)-5-methylpyrrolidin-2-one is used as an intermediate in the synthesis of various organic compounds, particularly in the preparation of Anthraquinone dyes. Anthraquinone dyes are a class of dyes known for their high color strength, lightfastness, and resistance to sublimation, making them suitable for use in the textile, paper, and plastic industries.
2. Used in Pharmaceutical Research:
1-(4-aminophenyl)-5-methylpyrrolidin-2-one is related to 3-(4-Aminophenyl)-1,3-oxazolidin-2-one (A625405), which has potential applications in the development of pharmaceuticals. The compound's unique structure may be utilized in the design and synthesis of new drugs targeting specific biological pathways or receptors.
3. Used in Material Science:
The compound's chemical properties may also make it a candidate for use in the development of new materials with specific characteristics, such as improved stability, reactivity, or solubility. This could have applications in various industries, including coatings, adhesives, and polymers.
Check Digit Verification of cas no
The CAS Registry Mumber 13691-28-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,9 and 1 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 13691-28:
(7*1)+(6*3)+(5*6)+(4*9)+(3*1)+(2*2)+(1*8)=106
106 % 10 = 6
So 13691-28-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O/c1-8-2-7-11(14)13(8)10-5-3-9(12)4-6-10/h3-6,8H,2,7,12H2,1H3
13691-28-6Relevant articles and documents
Catalyst-free transformation of levulinic acid into pyrrolidinones with formic acid
Wei, Yawen,Wang, Chao,Jiang, Xue,Xue, Dong,Liu, Zhao-Tie,Xiao, Jianliang
supporting information, p. 1093 - 1096 (2014/03/21)
Levulinic acid (LA) is transformed into pyrrolidinones by formic acid in DMSO without a catalyst. Mechanistic studies suggest the involvement of an iminium intermediate and a rate-limiting hydride transfer step.
