137394-53-7 Usage
General Description
1(2H)-Pyrimidineacetic acid, 3-(3-(3,6-dihydro-3-methyl-2,6-dioxo-1(2H)-pyrimidinyl)propyl)-3,4-dihydro-2,4-dioxo-, methyl ester is a complex organic compound with a long chemical name. It is derived from pyrimidine, a heterocyclic compound that contains nitrogen atoms in the ring structure. This specific compound contains a methyl ester group, which is a functional group consisting of a carbonyl group attached to an oxygen atom and a methyl group. The compound also contains various other functional groups, including carboxylic acid and ketone groups. The presence of these functional groups gives the compound potential pharmaceutical or biological activity, making it a subject of interest in medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 137394-53-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,3,9 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 137394-53:
(8*1)+(7*3)+(6*7)+(5*3)+(4*9)+(3*4)+(2*5)+(1*3)=147
147 % 10 = 7
So 137394-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N4O6/c1-16-8-4-11(20)18(14(16)23)6-3-7-19-12(21)5-9-17(15(19)24)10-13(22)25-2/h4-5,8-9H,3,6-7,10H2,1-2H3