13742-05-7 Usage
Uses
Used in Organic Synthesis:
Benzo[a]phenazine-5,6-dione is used as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of specialty chemicals and pharmaceuticals.
Used in Pharmaceutical Research:
In pharmaceutical research, Benzo[a]phenazine-5,6-dione is employed as a precursor for the synthesis of biologically active compounds. Its potential to contribute to the development of new drugs and medicines is significant, given its diverse biological activities and pharmacological properties.
Used in Drug Development:
Benzo[a]phenazine-5,6-dione is utilized in the development of new drugs and medicines, where its unique chemical structure and properties can be leveraged to create novel therapeutic agents. Its potential applications in medicine are broad, spanning various therapeutic areas, and it is subject to ongoing research to explore its full potential.
Check Digit Verification of cas no
The CAS Registry Mumber 13742-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,4 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13742-05:
(7*1)+(6*3)+(5*7)+(4*4)+(3*2)+(2*0)+(1*5)=87
87 % 10 = 7
So 13742-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H8N2O2/c19-15-10-6-2-1-5-9(10)13-14(16(15)20)18-12-8-4-3-7-11(12)17-13/h1-8H
