13837-95-1 Usage
Uses
Used in Organic Synthesis:
(3R)-1-methylidene-3-prop-1-en-2-yl-cyclohexane is used as a key intermediate in organic synthesis for the creation of various complex molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of a wide range of organic compounds.
Used in Pharmaceutical Production:
In the pharmaceutical industry, (3R)-1-methylidene-3-prop-1-en-2-yl-cyclohexane serves as a chemical intermediate. Its incorporation into the synthesis of drugs can lead to the development of new medications with specific therapeutic properties, contributing to advancements in healthcare.
Used in Research and Development:
(3R)-1-methylidene-3-prop-1-en-2-yl-cyclohexane is also utilized in research settings within the field of organic chemistry. Its distinctive structure and reactivity make it an interesting subject for studies aimed at understanding and optimizing chemical reactions and processes. This research can lead to the discovery of new synthetic pathways and the creation of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 13837-95-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,8,3 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13837-95:
(7*1)+(6*3)+(5*8)+(4*3)+(3*7)+(2*9)+(1*5)=121
121 % 10 = 1
So 13837-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H16/c1-8(2)10-6-4-5-9(3)7-10/h10H,1,3-7H2,2H3/t10-/m1/s1