139-26-4 Usage
Description
3-Fluoro-DL-Tyrosine is a synthetic, non-proteinogenic amino acid that belongs to the class of organic molecules known as phenylalanine and derivatives. It contains a fluorine atom attached to the phenyl ring of tyrosine, which gives it unique properties and potential therapeutic applications.
Uses
Used in Pharmaceutical Synthesis:
3-Fluoro-DL-Tyrosine is used as a chemical reagent in the synthesis of various pharmaceuticals and bioactive compounds. Its unique structure allows for the selective labeling and modification of proteins, making it a valuable tool in drug development.
Used in Radiolabeling for Imaging:
3-Fluoro-DL-Tyrosine has been studied for its potential use as a radiolabeling agent for positron emission tomography (PET) imaging. This application could enhance the visualization and diagnosis of certain diseases and conditions by providing detailed images of biological processes in the body.
Used in Research and Development:
Due to its ability to selectively label and modify proteins, 3-Fluoro-DL-Tyrosine is utilized in research and development for studying protein functions, interactions, and mechanisms. This can contribute to a better understanding of various biological processes and the development of new therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 139-26-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,3 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 139-26:
(5*1)+(4*3)+(3*9)+(2*2)+(1*6)=54
54 % 10 = 4
So 139-26-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10FNO3/c10-11-8(9(13)14)5-6-1-3-7(12)4-2-6/h1-4,8,11-12H,5H2,(H,13,14)
