139122-76-2 Usage
Uses
Used in Neurological Applications:
5,6-Dihydro-4-(2-methyl-2-phenylhydrazino)-2-1H-pyridinone is used as a potential therapeutic agent for the treatment of neurological disorders such as Parkinson's disease. It functions by inhibiting the enzyme monoamine oxidase B (MAO-B), which helps regulate dopamine levels in the brain, thereby potentially alleviating the symptoms associated with Parkinson's disease.
Used in Oncology Applications:
In the field of oncology, 5,6-Dihydro-4-(2-methyl-2-phenylhydrazino)-2-1H-pyridinone is used as a potential anti-cancer agent. It has shown inhibitory effects on the growth and proliferation of cancer cells, making it a promising candidate for further research and development in cancer treatment.
Used in Pharmaceutical Industry:
5,6-Dihydro-4-(2-methyl-2-phenylhydrazino)-2-1H-pyridinone is used as a chemical compound with potential medicinal properties in the pharmaceutical industry. Its ability to inhibit monoamine oxidase B (MAO-B) and its anti-cancer properties make it a valuable candidate for the development of new drugs and therapies for neurological disorders and cancer treatment.
Used in Research and Development:
In the research and development sector, 5,6-Dihydro-4-(2-methyl-2-phenylhydrazino)-2-1H-pyridinone is used as a subject of study for its potential therapeutic applications. Scientists and researchers are exploring its inhibitory effects on monoamine oxidase B (MAO-B) and its anti-cancer properties to better understand its potential benefits and develop new treatments for neurological disorders and cancer.
Used in Drug Discovery:
5,6-Dihydro-4-(2-methyl-2-phenylhydrazino)-2-1H-pyridinone is used as a starting point for drug discovery in the field of medicinal chemistry. Its unique properties and potential applications in treating neurological disorders and cancer make it an attractive compound for further exploration and development into new drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 139122-76-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,1,2 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 139122-76:
(8*1)+(7*3)+(6*9)+(5*1)+(4*2)+(3*2)+(2*7)+(1*6)=122
122 % 10 = 2
So 139122-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3O/c1-15(11-5-3-2-4-6-11)14-10-7-8-13-12(16)9-10/h2-6,9,14H,7-8H2,1H3,(H,13,16)
