139122-76-2 Usage
General Description
5,6-Dihydro-4-(2-methyl-2-phenylhydrazino)-2-1H-pyridinone, also known as MPTP, is a chemical compound with potential medicinal properties. It has demonstrated inhibitory effects on the enzyme monoamine oxidase B (MAO-B), which plays a role in the regulation of dopamine levels in the brain. This suggests that MPTP may have potential applications in the treatment of neurological disorders such as Parkinson's disease, which is characterized by a decrease in dopamine levels. Additionally, MPTP has been studied for its potential anti-cancer properties, as it has shown inhibitory effects on the growth and proliferation of cancer cells. Overall, the chemical compound 5,6-Dihydro-4-(2-methyl-2-phenylhydrazino)-2-1H-pyridinone presents an intriguing area of research for its potential therapeutic applications in the fields of neurology and oncology.
Check Digit Verification of cas no
The CAS Registry Mumber 139122-76-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,1,2 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 139122-76:
(8*1)+(7*3)+(6*9)+(5*1)+(4*2)+(3*2)+(2*7)+(1*6)=122
122 % 10 = 2
So 139122-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3O/c1-15(11-5-3-2-4-6-11)14-10-7-8-13-12(16)9-10/h2-6,9,14H,7-8H2,1H3,(H,13,16)
