139719-13-4 Usage
Uses
Used in Industrial Applications:
2,4,5,7-Tetramethylquinoline is used as a fluorescent dye for its ability to emit light when exposed to certain wavelengths, making it valuable in various industrial processes that require detection or visualization of specific materials.
Used as an Intermediate in Chemical Synthesis:
In the chemical industry, 2,4,5,7-Tetramethylquinoline serves as an intermediate in the production of other compounds, contributing to the synthesis of a range of products that may have diverse applications in various sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 139719-13-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,9,7,1 and 9 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 139719-13:
(8*1)+(7*3)+(6*9)+(5*7)+(4*1)+(3*9)+(2*1)+(1*3)=154
154 % 10 = 4
So 139719-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H15N/c1-8-5-9(2)13-10(3)7-11(4)14-12(13)6-8/h5-7H,1-4H3
