1400-46-0 Usage
General Description
Mycobactin is a group of small molecule compounds produced by mycobacteria, particularly Mycobacterium tuberculosis, to scavenge iron from the host environment. These compounds are siderophores, which are known for their high affinity for iron and ability to chelate the metal ions. Mycobactin is crucial for the survival and pathogenicity of mycobacteria, as iron is an essential nutrient for bacterial growth and virulence. The discovery and understanding of mycobactin have led to the development of potential new targets for the treatment of tuberculosis and other mycobacterial infections. Additionally, the study of mycobactin has provided valuable insights into the mechanisms of iron acquisition and utilization by pathogenic bacteria.
Check Digit Verification of cas no
The CAS Registry Mumber 1400-46-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,0 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1400-46:
(6*1)+(5*4)+(4*0)+(3*0)+(2*4)+(1*6)=40
40 % 10 = 0
So 1400-46-0 is a valid CAS Registry Number.
InChI:InChI=1/C27H37N5O10/c33-17-31(39)13-6-1-2-10-20(29-24(36)21-16-42-25(30-21)18-8-3-4-11-22(18)34)27(38)41-15-12-23(35)28-19-9-5-7-14-32(40)26(19)37/h3-4,8,11,17,19-21,30,39-40H,1-2,5-7,9-10,12-16H2,(H,28,35)(H,29,36)/b25-18-