14133-36-9 Usage
Uses
Used in Pharmaceutical Synthesis:
METHYL-3-AMINO-3-DEOXY-B-D-GLUCOPYRANOS IDE is used as a key intermediate in the synthesis of pharmaceuticals, particularly for the development of glycosidase inhibitors. Its unique structure allows for the creation of novel compounds with potential therapeutic applications.
Used in Medicinal Chemistry Research:
METHYL-3-AMINO-3-DEOXY-B-D-GLUCOPYRANOS IDE is employed as a valuable building block in medicinal chemistry research. Its structure and properties enable the preparation of various bioactive molecules, contributing to the discovery of new drugs and therapeutic agents.
Used in Drug Development:
In the field of drug development, METHYL-3-AMINO-3-DEOXY-B-D-GLUCOPYRANOS IDE is utilized for its potential biological activities, such as antimicrobial and antitumor properties. Its presence in the synthesis of new compounds can lead to the development of innovative treatments for various diseases and conditions.
Used in Antimicrobial Applications:
METHYL-3-AMINO-3-DEOXY-B-D-GLUCOPYRANOS IDE is used as an antimicrobial agent, exhibiting potential activity against various microorganisms. Its incorporation into pharmaceutical compounds can contribute to the development of new antibiotics and antimicrobial drugs.
Used in Antitumor Applications:
METHYL-3-AMINO-3-DEOXY-B-D-GLUCOPYRANOS IDE is used as an antitumor agent, showing promise in the development of cancer treatments. Its potential to inhibit tumor growth and progression can be leveraged in the creation of novel anticancer drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 14133-36-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,3 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 14133-36:
(7*1)+(6*4)+(5*1)+(4*3)+(3*3)+(2*3)+(1*6)=69
69 % 10 = 9
So 14133-36-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO5/c1-12-7-6(11)4(8)5(10)3(2-9)13-7/h3-7,9-11H,2,8H2,1H3
14133-36-9Relevant academic research and scientific papers
A stereocontrolled synthesis of 3-acetamido-1,3,5-trideoxy- and 1,3,5,6-tetradeoxy-1,5-imino-d-glucitol
Simak, Ondrej,Stanek, Jan,Moravcova, Jitka
experimental part, p. 966 - 971 (2009/09/05)
3-Acetamido-5-amino-3,5,6-trideoxy-d-glucono-1,5-lactam and 3-acetamido-5-amino-3,5-dideoxy-d-glucono-1,5-lactam were synthesized from corresponding 3-acetamido-3-deoxy-β-d-glucopyranosides in 63% and 35% overall yield, respectively. Acetylation followed by reduction led to the title 3-acetamido-3-deoxy derivatives of both deoxynojirimycin and 1,6-dideoxynojirimycin. The procedure developed is useful for a multi-gram scale.
