14178-45-1 Usage
Uses
Used in Organic Synthesis:
2-CYANO-5-CARBOXAMIDOPYRIDINE is used as a building block for the production of various drugs due to its unique structural properties and functional groups, which facilitate the creation of a wide range of compounds with potential applications in the pharmaceutical industry.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-CYANO-5-CARBOXAMIDOPYRIDINE is used as a research intermediate to develop new drugs. Its presence in the synthesis process allows for the exploration of its potential in creating compounds with therapeutic effects.
Used as an Enzyme Inhibitor:
2-CYANO-5-CARBOXAMIDOPYRIDINE has been studied for its potential as an inhibitor of various enzymes. Its application in this area is significant for medicinal chemistry research, as enzyme inhibition can lead to the development of treatments for various diseases and conditions.
Used in Drug Discovery and Development:
2-CYANO-5-CARBOXAMIDOPYRIDINE's versatility and importance in the field of chemistry make it a key component in drug discovery and development processes. Its potential applications in creating new pharmaceuticals highlight its value in advancing medical treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 14178-45-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,7 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 14178-45:
(7*1)+(6*4)+(5*1)+(4*7)+(3*8)+(2*4)+(1*5)=101
101 % 10 = 1
So 14178-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O/c8-3-6-2-1-5(4-10-6)7(9)11/h1-2,4H,(H2,9,11)
