142797-33-9 Usage
Description
METHYL 2,3,4-TRI-O-BENZYL-BETA-D-GLUCURONIC ACID, BENZYL ESTER, with the CAS number 142797-33-9, is a synthetic compound that plays a significant role in the field of organic synthesis. It is characterized by its unique chemical structure, which features a glucuronic acid backbone with benzyl groups attached at the 2, 3, and 4 positions, and an additional benzyl ester group. This structure endows the compound with specific properties that make it valuable for various applications in chemical research and development.
Uses
1. Used in Organic Synthesis:
METHYL 2,3,4-TRI-O-BENZYL-BETA-D-GLUCURONIC ACID, BENZYL ESTER is used as an intermediate in organic synthesis for the development of complex organic molecules. Its unique structure allows for further functionalization and modification, making it a versatile building block for the creation of novel compounds with potential applications in various industries.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, METHYL 2,3,4-TRI-O-BENZYL-BETA-D-GLUCURONIC ACID, BENZYL ESTER is used as a key component in the synthesis of drug candidates. Its structural features can be exploited to design and develop new drugs with improved pharmacological properties, such as enhanced bioavailability, selectivity, and reduced side effects.
3. Used in Chemical Research:
METHYL 2,3,4-TRI-O-BENZYL-BETA-D-GLUCURONIC ACID, BENZYL ESTER is also utilized in chemical research to study the reactivity and properties of glucuronic acid derivatives. This knowledge can be applied to develop new synthetic methods, catalysts, and strategies for the preparation of other complex organic molecules.
4. Used in Material Science:
In the field of material science, METHYL 2,3,4-TRI-O-BENZYL-BETA-D-GLUCURONIC ACID, BENZYL ESTER can be employed as a component in the development of novel materials with specific properties. For example, its incorporation into polymers or other materials could lead to the creation of materials with enhanced mechanical, thermal, or biological properties.
5. Used in Analytical Chemistry:
METHYL 2,3,4-TRI-O-BENZYL-BETA-D-GLUCURONIC ACID, BENZYL ESTER can be used as a reference compound or standard in analytical chemistry for the development and validation of new analytical methods, such as chromatography, mass spectrometry, or nuclear magnetic resonance (NMR) spectroscopy. Its unique structure and properties make it an ideal candidate for these applications.
Check Digit Verification of cas no
The CAS Registry Mumber 142797-33-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,7,9 and 7 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 142797-33:
(8*1)+(7*4)+(6*2)+(5*7)+(4*9)+(3*7)+(2*3)+(1*3)=149
149 % 10 = 9
So 142797-33-9 is a valid CAS Registry Number.
InChI:InChI=1/C35H36O7/c1-37-35-33(40-24-28-18-10-4-11-19-28)31(39-23-27-16-8-3-9-17-27)30(38-22-26-14-6-2-7-15-26)32(42-35)34(36)41-25-29-20-12-5-13-21-29/h2-21,30-33,35H,22-25H2,1H3
142797-33-9Relevant articles and documents
Synthesis of bile acid 24-acyl glucuronides
Goto, Junichi,Murao, Naoaki,Oohashi, Junji,Ikegawa, Shigeo
, p. 180 - 185 (2007/10/03)
The synthesis of acyl glucuronides of common bile acids is described. By means of the Mitsunobu reaction employing diethylazodicarboxylate and triphenylphosphine, bile acids were condensed through the inherent C-24 carboxy group with benzyl 2,3,4-tri-O-benzyl-D-glucopyranuronate, which was prepared from 1-O-methyl-α-D-glucose. The separation and purification of the β2-anomers at the anomeric position of the sugar moiety were attained by preparative thin-layer chromatography and/or high-performance liquid chromatography on a column packed with phenyl-bonded silica using H2O-MeOH as a mobile phase. The removal of the benyl group on the sugar moiety was achieved by catalytic hydrogenation with 10% palladium on carbon to yield the desired acyl glucuronides of bile acids. The structures of these acyl glucuronides were confirmed by proton nuclear magnetic resonance spectral properties.