143525-69-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Methyl-4-pyrrolidin-1-yl aniline hydrochloride is used as a chemical intermediate for the synthesis of various drugs and organic compounds. Its role in the pharmaceutical industry is crucial for the production of a range of medicinal products, contributing to the development of new therapeutic agents.
Used in Organic Chemistry:
In the field of organic chemistry, 2-Methyl-4-pyrrolidin-1-yl aniline hydrochloride serves as a versatile building block for the creation of complex organic molecules. Its unique structure allows for various chemical reactions, facilitating the synthesis of a wide array of compounds for research and commercial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 143525-69-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,5,2 and 5 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 143525-69:
(8*1)+(7*4)+(6*3)+(5*5)+(4*2)+(3*5)+(2*6)+(1*9)=123
123 % 10 = 3
So 143525-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2/c1-9-8-10(4-5-11(9)12)13-6-2-3-7-13/h4-5,8H,2-3,6-7,12H2,1H3
