1445-56-3 Usage
Description
3-Chloropyridazine-4-carbonitrile is a chemical compound with the molecular formula C5H2ClN3. It is a derivative of pyridazine, featuring a chlorine atom and a cyano group attached to the 3rd and 4th carbon atoms, respectively. This versatile chemical is known for its potential applications in the pharmaceutical industry and organic synthesis, serving as a building block for the synthesis of various biologically active compounds and as a reagent in chemical reactions.
Uses
Used in Pharmaceutical Industry:
3-Chloropyridazine-4-carbonitrile is used as a building block for the synthesis of biologically active compounds due to its unique chemical structure and properties. It contributes to the development of new drugs with potential therapeutic effects.
Used in Organic Synthesis:
In the field of organic synthesis, 3-Chloropyridazine-4-carbonitrile is utilized as a reagent in chemical reactions, facilitating the formation of desired products and enhancing the efficiency of synthetic processes.
Used in Chemical Research:
3-Chloropyridazine-4-carbonitrile serves as a valuable compound for chemical research, enabling scientists to explore its properties, reactivity, and potential applications in various chemical transformations and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 1445-56-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,4 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1445-56:
(6*1)+(5*4)+(4*4)+(3*5)+(2*5)+(1*6)=73
73 % 10 = 3
So 1445-56-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H2ClN3/c6-5-4(3-7)1-2-8-9-5/h1-2H