144584-29-2 Usage
Uses
Used in Chemical Synthesis:
3-Bromo-2-chloro-4-methoxypyridine is used as a reagent in chemical synthesis for the preparation of various organic compounds. Its unique structure and functional groups enable it to participate in a range of reactions, such as nucleophilic substitution, electrophilic aromatic substitution, and cross-coupling reactions, facilitating the synthesis of diverse organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-Bromo-2-chloro-4-methoxypyridine is used as a key intermediate in the development of new drugs. Its structural features make it a valuable building block for the synthesis of bioactive molecules with potential therapeutic applications. Researchers leverage its reactivity to design and optimize drug candidates targeting various diseases and conditions.
Used in Material Science:
3-Bromo-2-chloro-4-methoxypyridine is also employed in material science for the synthesis of novel materials with specific properties. Its ability to form various types of bonds and its compatibility with different chemical systems make it a useful component in the development of advanced materials for applications such as sensors, catalysts, and functional coatings.
Used in Analytical Chemistry:
In analytical chemistry, 3-Bromo-2-chloro-4-methoxypyridine serves as a reference compound or a derivatizing agent for the analysis of complex samples. Its distinct chemical properties allow for the selective detection and quantification of target analytes, enhancing the sensitivity and accuracy of analytical methods.
Overall, 3-Bromo-2-chloro-4-methoxypyridine is a valuable chemical entity with diverse applications across various scientific and industrial fields, including chemical synthesis, pharmaceutical research, material science, and analytical chemistry. Its unique structural features and reactivity make it an essential component in the development of innovative solutions and advancements in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 144584-29-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,4,5,8 and 4 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 144584-29:
(8*1)+(7*4)+(6*4)+(5*5)+(4*8)+(3*4)+(2*2)+(1*9)=142
142 % 10 = 2
So 144584-29-2 is a valid CAS Registry Number.
InChI:InChI=1S/C6H5BrClNO/c1-10-4-2-3-9-6(8)5(4)7/h2-3H,1H3
144584-29-2Relevant academic research and scientific papers
Walters,Carter,Banerjee
, p. 2829 - 2837 (1992)
3-Bromo-2-chloro-4-methoxypyridine has been developed as a practical 2,3-pyridine precursor. The substituted 2,3-pyridine generated from this precursor by halogen-metal exchange has been found to react regioselectively with 2-methoxyfuran and 2-methylfuran.
