14469-84-2 Usage
Description
1-BROMO-5-(4-METHOXYPHENYL)PENTANE is a chemical compound that belongs to the class of Organobromides. It is characterized by the presence of a bromine atom bonded to a carbon atom, a methoxyphenyl group (an aromatic functional group consisting of a phenyl ring bonded to a methoxy -OCH3 group), and a pentane structure, which is an alkane with five carbon atoms. The molecular structure of this compound endows it with specific physical and chemical properties, making it suitable for applications in organic synthesis. It is typically produced in a laboratory setting, and its toxicity, reactivity, and environmental impact should be referred to in its Material Safety Data Sheet (MSDS).
Uses
Used in Organic Synthesis:
1-BROMO-5-(4-METHOXYPHENYL)PENTANE is used as a chemical intermediate for the synthesis of various organic compounds. Its unique molecular structure allows it to be a valuable building block in the creation of more complex molecules, which can be utilized in a wide range of applications, including pharmaceuticals, agrochemicals, and materials science.
Used in Pharmaceutical Industry:
1-BROMO-5-(4-METHOXYPHENYL)PENTANE is used as a key component in the development of new drugs. Its molecular structure can be modified to create potential therapeutic agents, which can be tested for their efficacy in treating various diseases and medical conditions.
Used in Agrochemical Industry:
1-BROMO-5-(4-METHOXYPHENYL)PENTANE is used as a starting material for the synthesis of agrochemicals, such as pesticides and herbicides. Its chemical properties can be tailored to create compounds that are effective in controlling pests and weeds in agricultural settings.
Used in Materials Science:
1-BROMO-5-(4-METHOXYPHENYL)PENTANE is used as a precursor in the development of new materials with specific properties, such as polymers with unique mechanical, thermal, or electrical characteristics. These materials can be used in various industries, including electronics, automotive, and aerospace.
Check Digit Verification of cas no
The CAS Registry Mumber 14469-84-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,4,6 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 14469-84:
(7*1)+(6*4)+(5*4)+(4*6)+(3*9)+(2*8)+(1*4)=122
122 % 10 = 2
So 14469-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H17BrO/c1-14-12-8-6-11(7-9-12)5-3-2-4-10-13/h6-9H,2-5,10H2,1H3
14469-84-2Relevant articles and documents
Materials Chemistry of Chiral Macromolecules. 1. Synthesis and Phase Transitions
Moore, J. S.,Stupp, S. I.
, p. 3429 - 3441 (2007/10/02)
This paper describes work on synthesis of chiral macromolecules as part of a materials chemistry study which seeks to establish links in these systems among molecular structure, three-dimensional molecular organization, and properties.The basic materials