146767-63-7 Usage
Uses
Used in Medicinal Chemistry:
1H-Pyrrolo[3,2-b]pyridine-5-carbonitrile(9CI) is used as a structural component in the development of new pharmaceuticals due to its heterocyclic nature and potential biological activity. Its unique fusion of pyrrole and pyridine rings, along with the carbonitrile group, may contribute to the creation of novel drug candidates with specific therapeutic effects.
Used in Drug Design:
In the field of drug design, 1H-Pyrrolo[3,2-b]pyridine-5-carbonitrile(9CI) serves as a valuable building block for the synthesis of complex organic molecules. Its incorporation into molecular structures can lead to the discovery of new compounds with desired pharmacological properties, such as improved binding affinity, selectivity, and bioavailability.
Used in Chemical Synthesis:
1H-Pyrrolo[3,2-b]pyridine-5-carbonitrile(9CI) is utilized as a key intermediate in the synthesis of various organic compounds. Its reactivity and structural features make it suitable for use in organic reactions, potentially leading to the formation of new chemical entities with diverse applications.
Used in Research and Development:
In the realm of research and development, 1H-Pyrrolo[3,2-b]pyridine-5-carbonitrile(9CI) is employed as a subject of study to explore its potential pharmacological properties and understand its characteristics. This research can provide insights into its mechanism of action, safety, and efficacy, which are crucial for its application in medicinal chemistry and drug design.
Check Digit Verification of cas no
The CAS Registry Mumber 146767-63-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,6,7,6 and 7 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 146767-63:
(8*1)+(7*4)+(6*6)+(5*7)+(4*6)+(3*7)+(2*6)+(1*3)=167
167 % 10 = 7
So 146767-63-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5N3/c9-5-6-1-2-7-8(11-6)3-4-10-7/h1-4,10H
146767-63-7Relevant articles and documents
4-Azaindole Derivatives
-
Paragraph 0511; 0512-0514, (2015/04/15)
4-Azaindole derivatives which are modulators of muscarinic acetylcholine receptor (mAChR) M1 and which may be effective for the prevention or disease modifying or symptomatic treatment of cognitive deficits associated with neurological disorders such as Alzheimer-type dementia (AD) or dementia with Lewy bodies (DLB), and a pharmaceutical composition comprising a 4-azaindole derivative as an active ingredient.
4-AZAINDOLE DERIVATIVES
-
Page/Page column 61; 62, (2015/04/22)
4-Azaindole derivatives which are modulators of muscarinic acetylcholine receptor (mAChR) M1 and which may be effective for the prevention or disease modifying or symptomatic treatment of cognitive deficits associated with neurological disorders such as Alzheimer-type dementia (AD) or dementia with Lewy bodies (DLB), and a pharmaceutical composition comprising a 4-azaindole derivative as an active ingredient.
