148356-06-3 Usage
Uses
Used in Pharmaceutical Synthesis:
4-(2-Aminoethyl)cyclohexanol (cisand transmixture) is used as a chiral building block for the synthesis of various pharmaceuticals and chemical compounds. Its unique structure and isomerism enable the creation of enantiomerically pure compounds, which is crucial for the development of effective and safe medications.
Used in Coordination Chemistry:
In the field of coordination chemistry, 4-(2-Aminoethyl)cyclohexanol (cisand transmixture) is utilized as a chelating agent. Its ability to form stable complexes with metal ions is essential for the study and application of metal-organic frameworks and other coordination compounds.
Used in Asymmetric Catalysis:
4-(2-Aminoethyl)cyclohexanol (cisand transmixture) also serves as a ligand in asymmetric catalysis. Its presence can influence the selectivity and efficiency of catalytic reactions, leading to the production of enantiomerically enriched products, which are vital in the synthesis of biologically active compounds and pharmaceuticals.
Used in Chemical Compound Synthesis:
Beyond pharmaceuticals, 4-(2-Aminoethyl)cyclohexanol (cisand transmixture) is employed as a chiral building block in the synthesis of a wide range of chemical compounds. Its versatility and the distinct properties of its isomers make it a valuable component in the development of new materials and chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 148356-06-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,3,5 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 148356-06:
(8*1)+(7*4)+(6*8)+(5*3)+(4*5)+(3*6)+(2*0)+(1*6)=143
143 % 10 = 3
So 148356-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H17NO/c9-6-5-7-1-3-8(10)4-2-7/h7-8,10H,1-6,9H2
