148367-97-9 Usage
Uses
Used in Organic Synthesis:
2-CHLORO-2-(2-PHENYLHYDRAZONO)-N-(2-CHLOROPHENYL)-ACETAMIDE is used as a synthetic intermediate for the preparation of various organic compounds. Its unique structure, including the presence of chloro and phenyl groups, allows it to participate in a range of chemical reactions, facilitating the synthesis of complex organic molecules.
Used in Coordination Chemistry as a Ligand:
In coordination chemistry, 2-CHLORO-2-(2-PHENYLHYDRAZONO)-N-(2-CHLOROPHENYL)-ACETAMIDE is employed as a ligand, interacting with metal ions to form coordination complexes. Its ability to chelate metal ions can be utilized in the development of catalysts, sensors, and materials with specific properties tailored for various applications.
Used in Pharmaceutical Industry:
2-CHLORO-2-(2-PHENYLHYDRAZONO)-N-(2-CHLOROPHENYL)-ACETAMIDE is used as a lead compound in drug discovery for its potential biological activity. Its structural features may offer opportunities for the development of new pharmaceutical agents, particularly in the areas of medicinal chemistry where its interactions with biological targets can be explored.
Used in Chemical Research:
2-CHLORO-2-(2-PHENYLHYDRAZONO)-N-(2-CHLOROPHENYL)-ACETAMIDE serves as a subject of study in chemical research, where its reactivity, stability, and mechanisms of interaction with other molecules are investigated. Understanding its properties can contribute to the advancement of chemical knowledge and the discovery of new applications.
Check Digit Verification of cas no
The CAS Registry Mumber 148367-97-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,3,6 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 148367-97:
(8*1)+(7*4)+(6*8)+(5*3)+(4*6)+(3*7)+(2*9)+(1*7)=169
169 % 10 = 9
So 148367-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H11Cl2N3O/c15-11-8-4-5-9-12(11)17-14(20)13(16)19-18-10-6-2-1-3-7-10/h1-9,18H,(H,17,20)/b19-13+
148367-97-9Relevant academic research and scientific papers
Frohberg, Petra,Drutkowski, Guntram,Wagner, Christoph
, p. 1654 - 1663 (2002)
Oxanilo-N-arylhydrazonoyl chlorides have been prepared from appropriate N-aryl-2-chloro-3-oxobutanamides by the Japp-Klingemann reaction. The structures of the title compounds have been established in the solid state by single-crystal X-ray structure determination and IR spectroscopy, and in solution by IR, UV, and 1H and 13C NMR spectroscopy. The results indicate that the hydrazonoyl chloride moiety adopts the (Z)-configured form. In the crystal, intramolecular hydrogen bonds generally exist between the chloride function and the hydrazone hydrogen atom, and also between the amide hydrogen atom and the double-bonded nitrogen atom of the hydrazone moiety. In solution, this intramolecular hydrogen bonding could not be detected. In compounds with an ortho-chloro-substituted NH-aryl moiety, however, the chlorine atom is involved in hydrogen bonding to the NH hydrogen atom both in the crystal and in solution. Wiley-VCH Verlag GmbH, 69451 Weinheim, Germany, 2002.
