148706-30-3 Usage
Description
4-Methoxy-2-methylphenylmagnesium bromide is a complex organometallic compound used in the field of chemistry. It is a Grignard reagent, named after the French chemist Fran?ois Auguste Victor Grignard, and consists of magnesium, bromide, and a 4-methoxy-2-methylphenyl group. This reagent is known for its highly reactive and sensitive properties to air or moisture, requiring careful handling. It is widely used in organic chemistry for creating new carbon-carbon bonds, facilitating the synthesis of a variety of organic compounds.
Uses
Used in Chemical Research:
4-Methoxy-2-methylphenylmagnesium bromide is used as a Grignard reagent for creating new carbon-carbon bonds in chemical research. Its reactivity allows for the synthesis of a wide range of organic compounds, making it a valuable tool in the development of new chemical entities.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 4-Methoxy-2-methylphenylmagnesium bromide is used as a key intermediate in the synthesis of various pharmaceuticals. Its ability to form new carbon-carbon bonds enables the production of complex molecules with potential therapeutic applications.
Used in Organic Synthesis:
4-Methoxy-2-methylphenylmagnesium bromide is employed as a reagent in organic synthesis for the creation of new carbon-carbon bonds. This allows for the development of novel organic compounds with potential applications in various fields, such as materials science, agrochemistry, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 148706-30-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,7,0 and 6 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 148706-30:
(8*1)+(7*4)+(6*8)+(5*7)+(4*0)+(3*6)+(2*3)+(1*0)=143
143 % 10 = 3
So 148706-30-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9O.BrH.Mg/c1-7-4-3-5-8(6-7)9-2;;/h3,5-6H,1-2H3;1H;/q;;+1/p-1/rC8H9BrMgO/c1-6-5-7(11-2)3-4-8(6)10-9/h3-5H,1-2H3
