14883-83-1 Usage
Description
(20α)-16,17-Didehydro-11-methoxy-19β-methyl-18-oxayohimban-16-carboxylic acid methyl ester is a complex organic compound that belongs to the class of alkaloids. It is fairly widespread among the members of the Rauwolfia species, where it is found mainly in the leaves. (20α)-16,17-Didehydro-11-methoxy-19β-methyl-18-oxayohimban-16-carboxylic acid methyl ester is characterized by its unique molecular structure, which includes a dehydrogenated dihydropyridine ring system, a methoxy group, and a carboxylic acid ester functional group. The compound's structure is further defined by the presence of a methyl group at the 19β position and an oxa bridge at the 18 position. The ultraviolet spectrum in ethanol exhibits three absorption maxima at 229, 265, and 282 mμ, which can be used for its identification and characterization.
Uses
1. Used in Pharmaceutical Industry:
(20α)-16,17-Didehydro-11-methoxy-19β-methyl-18-oxayohimban-16-carboxylic acid methyl ester is used as a pharmaceutical compound for its potential therapeutic applications. The compound's unique structure and functional groups may offer various biological activities, making it a promising candidate for the development of new drugs. Its alkaloid nature suggests that it may have effects on the nervous system, and further research could explore its potential in treating neurological disorders or as a component in the synthesis of other bioactive molecules.
2. Used in Chemical Research:
As a complex organic molecule, (20α)-16,17-Didehydro-11-methoxy-19β-methyl-18-oxayohimban-16-carboxylic acid methyl ester can be used in chemical research for understanding the structure-activity relationships of alkaloids and their derivatives. Its unique structural features may provide insights into the design and synthesis of novel compounds with improved biological activities or selectivity.
3. Used in Natural Product Chemistry:
(20α)-16,17-Didehydro-11-methoxy-19β-methyl-18-oxayohimban-16-carboxylic acid methyl ester can be utilized in the field of natural product chemistry, where it can serve as a starting material for the synthesis of new natural product-inspired compounds. Its isolation from the Rauwolfia species highlights the potential for discovering novel bioactive molecules from plant sources, which can be further optimized for specific applications.
4. Used in Analytical Chemistry:
The ultraviolet spectrum of (20α)-16,17-Didehydro-11-methoxy-19β-methyl-18-oxayohimban-16-carboxylic acid methyl ester, with its three absorption maxima, can be employed in analytical chemistry for the development of new methods for the identification and quantification of similar compounds. This can be particularly useful in the quality control and authentication of natural products containing this alkaloid.
References
Salkin, Hosansky, Janot.,l. Pharm. Sci., 50,1038 (1961)
Shamma, Richey.,J. Amer. Chem. Soc., 85,2507 (1963)
Check Digit Verification of cas no
The CAS Registry Mumber 14883-83-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,8,8 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 14883-83:
(7*1)+(6*4)+(5*8)+(4*8)+(3*3)+(2*8)+(1*3)=131
131 % 10 = 1
So 14883-83-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N2O4/c1-12-17-10-24-7-6-15-14-5-4-13(26-2)8-19(14)23-21(15)20(24)9-16(17)18(11-28-12)22(25)27-3/h4-5,8,11-12,16-17,20,23H,6-7,9-10H2,1-3H3/t12-,16+,17+,20+/m1/s1