14891-10-2 Usage
Uses
Used in Pharmaceutical Industry:
1-N-Ethoxycarbonyl-3-pyrrolidone is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure and reactivity make it a valuable component in the development of new pharmaceutical compounds, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 1-N-Ethoxycarbonyl-3-pyrrolidone serves as a key intermediate in the production of agrochemicals. Its ability to participate in various organic reactions facilitates the synthesis of effective and targeted agrochemicals, enhancing crop protection and yield.
Used as a Solvent in Industrial Processes:
1-N-Ethoxycarbonyl-3-pyrrolidone is utilized as a solvent in a wide range of industrial applications. Its solubility properties and stability make it suitable for dissolving various substances, enabling efficient processes in different industries.
Used in Organic Synthesis:
As a versatile chemical, 1-N-Ethoxycarbonyl-3-pyrrolidone is employed as a precursor to synthesize other compounds in organic synthesis. Its reactivity and functional groups allow for the formation of diverse chemical entities, expanding the scope of organic chemistry and contributing to the discovery of new materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 14891-10-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,8,9 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 14891-10:
(7*1)+(6*4)+(5*8)+(4*9)+(3*1)+(2*1)+(1*0)=112
112 % 10 = 2
So 14891-10-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO3/c1-2-11-7(10)8-4-3-6(9)5-8/h2-5H2,1H3
14891-10-2Relevant academic research and scientific papers
β-Ketoester Dianions as Regiospecific Enolate Equivalents for N-Substituted Pyrrolidin-3-ones
Giles, Melvyn,Hadley, Michael S.,Gallagher, Timothy
, p. 1047 - 1048 (2007/10/02)
Double deprotonation of β-ketoester (6) gives dianion (7) which serves as a synthetic equivalent of the regiospecific ketone enolate (3), providing a synthetic entry to 2-substituted pyrrolidin-3-ones (9) and (10).