149251-81-0 Usage
Uses
Used in Pharmaceutical Drug Preparation:
3-Amino-3-pyridin-2-yl-propionic acid is used as a key component in the development of pharmaceutical drugs due to its ability to be incorporated into the molecular structures of various therapeutic agents. Its unique chemical properties allow it to contribute to the efficacy and pharmacological profile of the resulting medications.
Used in Neurological and Inflammatory Condition Treatment:
In the field of medicine, 3-Amino-3-pyridin-2-yl-propionic acid is used as a potential treatment for certain neurological and inflammatory conditions. Its specific structure and functional groups are believed to have therapeutic effects that can be beneficial in managing or treating these conditions, although further research is needed to fully understand its potential applications in this area.
Used in Chemical Research:
3-Amino-3-pyridin-2-yl-propionic acid is utilized as a valuable tool in chemical research, where it serves as a building block for the synthesis of new compounds with potential biological activity. Its distinct structure allows researchers to explore its reactivity and interactions with other molecules, which can lead to the discovery of new drugs and therapeutic agents.
Used in Drug Development:
In the pharmaceutical industry, 3-Amino-3-pyridin-2-yl-propionic acid is used in drug development as a starting material or intermediate in the synthesis of novel compounds with potential medicinal properties. Its versatility in chemical reactions and its ability to be modified to create a variety of derivatives make it an important asset in the creation of new drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 149251-81-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,9,2,5 and 1 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 149251-81:
(8*1)+(7*4)+(6*9)+(5*2)+(4*5)+(3*1)+(2*8)+(1*1)=140
140 % 10 = 0
So 149251-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c9-6(5-8(11)12)7-3-1-2-4-10-7/h1-4,6H,5,9H2,(H,11,12)
